Carasinol B

Carasinol B

Identifiers
CAS number	777857-86-0
Jmol-3D images	Image 1
SMILES OC(C=C4)=CC=[C@@]4[C@@H]([C@@H]2[C@]3=CC(O)=CC(O)=C3)OC1=C2[C@@]([C@@H]5[C@@H]([C@]%11=CC=C(O)C=C%11)OC6=C5[C@]([C@@H]7[C@H]([C@]9=CC(O)=CC(O)=C9)[C@@H]([C@]%10=CC=C(O)C=C%10)O[C@H]7[C@]8=CC=C(O)C=C8)=CC(O)=C6)=CC(O)=C1
Properties
Molecular formula	C₅₆H₄₄O₁₃
Molar mass	924.94 g/mol
Exact mass	924.278191 u
Y (verify) (what is: Y/N?) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

Carasinol B is a stilben tetramer found in Caragana sinica (Chinese : Jin Que-gen).^[1]

Acid-catalyzed epimerization of kobophenol A to carasinol B can be performed in vitro.^[2]

References

Stilbenoids and their glycosides

of resveratrol	Piceid \| Trans-resveratrol-3-O-glucuronide

Oligomeric forms

of resveratrol	Ampelopsin E \| Dimers : ε-viniferin, Parthenocissin A, Quadrangularin A, Pallidol and Amurensin A \| Trimers : α-viniferin, Laevifonol (an ε-viniferin-ascorbic acid hybrid compound), Malaysianol A, trans-diptoindonesin B \| Tetramers : Hopeaphenol \| Vitisins A, B and C

Oligomeric forms glycosides

Diptoindonesin A | Laevifoside (O-glucoside of ampelopsin A)

Misc

Synthetic

Stilbenoid drugs